About 2,4-dimethyl-2H-1,3-oxazol-5-one
2,4-dimethyl-2H-1,3-oxazol-5-one (PubChem CID 45086565) has the molecular formula C5H7NO2
and a molecular weight of 113.12 g/mol. Its IUPAC name is 2,4-dimethyl-2H-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | 2,4-dimethyl-2H-1,3-oxazol-5-one |
| PubChem CID | 45086565 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.05 |
| IUPAC Name | 2,4-dimethyl-2H-1,3-oxazol-5-one |
| SMILES | CC1=NC(C)OC1=O |
| InChI | InChI=1S/C5H7NO2/c1-3-5(7)8-4(2)6-3/h4H,1-2H3 |
| InChIKey | SNDSTONKOZQHGP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dimethyl-2H-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-2H-1,3-oxazol-5-one?
The IUPAC name of 2,4-dimethyl-2H-1,3-oxazol-5-one (CID 45086565) is 2,4-dimethyl-2H-1,3-oxazol-5-one.
What is the SMILES notation for 2,4-dimethyl-2H-1,3-oxazol-5-one?
The canonical SMILES for 2,4-dimethyl-2H-1,3-oxazol-5-one is CC1=NC(C)OC1=O.
What is the InChIKey of 2,4-dimethyl-2H-1,3-oxazol-5-one?
The InChIKey is SNDSTONKOZQHGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2/c1-3-5(7)8-4(2)6-3/h4H,1-2H3.
What are the key properties of 2,4-dimethyl-2H-1,3-oxazol-5-one?
2,4-dimethyl-2H-1,3-oxazol-5-one has a molecular weight of 113.12 g/mol, XLogP of 0.35, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-2H-1,3-oxazol-5-one is sourced from PubChem (CID 45086565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).