methyl 4-methyl-1,3-oxazolidine-4-carboxylate

C6H11NO3 — CID 45086646

IUPACmethyl 4-methyl-1,3-oxazolidine-4-carboxylate
SMILESCOC(=O)C1(C)COCN1
InChIInChI=1S/C6H11NO3/c1-6(5(8)9-2)3-10-4-7-6/h7H,3-4H2,1-2H3
InChIKeyXCXDVTVNAHGBBF-UHFFFAOYSA-N
MW145.16 g/mol
LogP-0.50
Rot. Bonds1

About methyl 4-methyl-1,3-oxazolidine-4-carboxylate

methyl 4-methyl-1,3-oxazolidine-4-carboxylate (PubChem CID 45086646) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is methyl 4-methyl-1,3-oxazolidine-4-carboxylate.

Molecular Properties

Compound Namemethyl 4-methyl-1,3-oxazolidine-4-carboxylate
PubChem CID45086646
Molecular FormulaC6H11NO3
Molecular Weight145.16 g/mol
Exact Mass145.07
IUPAC Namemethyl 4-methyl-1,3-oxazolidine-4-carboxylate
SMILESCOC(=O)C1(C)COCN1
InChIInChI=1S/C6H11NO3/c1-6(5(8)9-2)3-10-4-7-6/h7H,3-4H2,1-2H3
InChIKeyXCXDVTVNAHGBBF-UHFFFAOYSA-N
XLogP-0.50
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500145.16
LogP ≤ 5-0.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 4-methyl-1,3-oxazolidine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-methyl-1,3-oxazolidine-4-carboxylate?
The IUPAC name of methyl 4-methyl-1,3-oxazolidine-4-carboxylate (CID 45086646) is methyl 4-methyl-1,3-oxazolidine-4-carboxylate.
What is the SMILES notation for methyl 4-methyl-1,3-oxazolidine-4-carboxylate?
The canonical SMILES for methyl 4-methyl-1,3-oxazolidine-4-carboxylate is COC(=O)C1(C)COCN1.
What is the InChIKey of methyl 4-methyl-1,3-oxazolidine-4-carboxylate?
The InChIKey is XCXDVTVNAHGBBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3/c1-6(5(8)9-2)3-10-4-7-6/h7H,3-4H2,1-2H3.
What are the key properties of methyl 4-methyl-1,3-oxazolidine-4-carboxylate?
methyl 4-methyl-1,3-oxazolidine-4-carboxylate has a molecular weight of 145.16 g/mol, XLogP of -0.50, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methyl-1,3-oxazolidine-4-carboxylate is sourced from PubChem (CID 45086646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).