About 2,3-dihydroxypropyl (2S)-2-aminopropanoate
2,3-dihydroxypropyl (2S)-2-aminopropanoate (PubChem CID 45086738) has the molecular formula C6H13NO4
and a molecular weight of 163.17 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (2S)-2-aminopropanoate.
Molecular Properties
| Compound Name | 2,3-dihydroxypropyl (2S)-2-aminopropanoate |
| PubChem CID | 45086738 |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 2,3-dihydroxypropyl (2S)-2-aminopropanoate |
| SMILES | C[C@H](N)C(=O)OCC(O)CO |
| InChI | InChI=1S/C6H13NO4/c1-4(7)6(10)11-3-5(9)2-8/h4-5,8-9H,2-3,7H2,1H3/t4-,5?/m0/s1 |
| InChIKey | XFGOYBHCRRBKHR-ROLXFIACSA-N |
| XLogP | -1.77 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,3-dihydroxypropyl (2S)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxypropyl (2S)-2-aminopropanoate?
The IUPAC name of 2,3-dihydroxypropyl (2S)-2-aminopropanoate (CID 45086738) is 2,3-dihydroxypropyl (2S)-2-aminopropanoate.
What is the SMILES notation for 2,3-dihydroxypropyl (2S)-2-aminopropanoate?
The canonical SMILES for 2,3-dihydroxypropyl (2S)-2-aminopropanoate is C[C@H](N)C(=O)OCC(O)CO.
What is the InChIKey of 2,3-dihydroxypropyl (2S)-2-aminopropanoate?
The InChIKey is XFGOYBHCRRBKHR-ROLXFIACSA-N. The full InChI is InChI=1S/C6H13NO4/c1-4(7)6(10)11-3-5(9)2-8/h4-5,8-9H,2-3,7H2,1H3/t4-,5?/m0/s1.
What are the key properties of 2,3-dihydroxypropyl (2S)-2-aminopropanoate?
2,3-dihydroxypropyl (2S)-2-aminopropanoate has a molecular weight of 163.17 g/mol, XLogP of -1.77, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypropyl (2S)-2-aminopropanoate is sourced from PubChem (CID 45086738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).