About 5H-imidazo[1,2-c][1,3]oxazine
5H-imidazo[1,2-c][1,3]oxazine (PubChem CID 45087136) has the molecular formula C6H6N2O
and a molecular weight of 122.13 g/mol. Its IUPAC name is 5H-imidazo[1,2-c][1,3]oxazine.
Molecular Properties
| Compound Name | 5H-imidazo[1,2-c][1,3]oxazine |
| PubChem CID | 45087136 |
| Molecular Formula | C6H6N2O |
| Molecular Weight | 122.13 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | 5H-imidazo[1,2-c][1,3]oxazine |
| SMILES | C1=Cc2nccn2CO1 |
| InChI | InChI=1S/C6H6N2O/c1-4-9-5-8-3-2-7-6(1)8/h1-4H,5H2 |
| InChIKey | USIRRCCEHGBRRA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.13 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5H-imidazo[1,2-c][1,3]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-imidazo[1,2-c][1,3]oxazine?
The IUPAC name of 5H-imidazo[1,2-c][1,3]oxazine (CID 45087136) is 5H-imidazo[1,2-c][1,3]oxazine.
What is the SMILES notation for 5H-imidazo[1,2-c][1,3]oxazine?
The canonical SMILES for 5H-imidazo[1,2-c][1,3]oxazine is C1=Cc2nccn2CO1.
What is the InChIKey of 5H-imidazo[1,2-c][1,3]oxazine?
The InChIKey is USIRRCCEHGBRRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O/c1-4-9-5-8-3-2-7-6(1)8/h1-4H,5H2.
What are the key properties of 5H-imidazo[1,2-c][1,3]oxazine?
5H-imidazo[1,2-c][1,3]oxazine has a molecular weight of 122.13 g/mol, XLogP of 0.84, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-imidazo[1,2-c][1,3]oxazine is sourced from PubChem (CID 45087136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).