C6H11NO2 — CID 45087395
1-(4-methyl-1,3-oxazolidin-3-yl)ethanone (PubChem CID 45087395) has the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. Its IUPAC name is 1-(4-methyl-1,3-oxazolidin-3-yl)ethanone.
| Compound Name | 1-(4-methyl-1,3-oxazolidin-3-yl)ethanone |
|---|---|
| PubChem CID | 45087395 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 1-(4-methyl-1,3-oxazolidin-3-yl)ethanone |
| SMILES | CC(=O)N1COCC1C |
| InChI | InChI=1S/C6H11NO2/c1-5-3-9-4-7(5)6(2)8/h5H,3-4H2,1-2H3 |
| InChIKey | PRFBRGSZUSGDJV-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |