About 1H-azirino[2,3-a]indolizine
1H-azirino[2,3-a]indolizine (PubChem CID 45087425) has the molecular formula C8H6N2
and a molecular weight of 130.15 g/mol. Its IUPAC name is 1H-azirino[2,3-a]indolizine.
Molecular Properties
| Compound Name | 1H-azirino[2,3-a]indolizine |
| PubChem CID | 45087425 |
| Molecular Formula | C8H6N2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | 1H-azirino[2,3-a]indolizine |
| SMILES | c1ccn2cc3c(c2c1)N3 |
| InChI | InChI=1S/C8H6N2/c1-2-4-10-5-6-8(9-6)7(10)3-1/h1-5,9H |
| InChIKey | AIKMRTXZNROLLS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 26.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1H-azirino[2,3-a]indolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-azirino[2,3-a]indolizine?
The IUPAC name of 1H-azirino[2,3-a]indolizine (CID 45087425) is 1H-azirino[2,3-a]indolizine.
What is the SMILES notation for 1H-azirino[2,3-a]indolizine?
The canonical SMILES for 1H-azirino[2,3-a]indolizine is c1ccn2cc3c(c2c1)N3.
What is the InChIKey of 1H-azirino[2,3-a]indolizine?
The InChIKey is AIKMRTXZNROLLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2/c1-2-4-10-5-6-8(9-6)7(10)3-1/h1-5,9H.
What are the key properties of 1H-azirino[2,3-a]indolizine?
1H-azirino[2,3-a]indolizine has a molecular weight of 130.15 g/mol, XLogP of 2.00, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-azirino[2,3-a]indolizine is sourced from PubChem (CID 45087425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).