About 7-methylpyrrolo[1,2-a]pyrazine
7-methylpyrrolo[1,2-a]pyrazine (PubChem CID 45087516) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is 7-methylpyrrolo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 7-methylpyrrolo[1,2-a]pyrazine |
| PubChem CID | 45087516 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 7-methylpyrrolo[1,2-a]pyrazine |
| SMILES | Cc1cc2cnccn2c1 |
| InChI | InChI=1S/C8H8N2/c1-7-4-8-5-9-2-3-10(8)6-7/h2-6H,1H3 |
| InChIKey | DGZYEJNNAMDYJB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methylpyrrolo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylpyrrolo[1,2-a]pyrazine?
The IUPAC name of 7-methylpyrrolo[1,2-a]pyrazine (CID 45087516) is 7-methylpyrrolo[1,2-a]pyrazine.
What is the SMILES notation for 7-methylpyrrolo[1,2-a]pyrazine?
The canonical SMILES for 7-methylpyrrolo[1,2-a]pyrazine is Cc1cc2cnccn2c1.
What is the InChIKey of 7-methylpyrrolo[1,2-a]pyrazine?
The InChIKey is DGZYEJNNAMDYJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c1-7-4-8-5-9-2-3-10(8)6-7/h2-6H,1H3.
What are the key properties of 7-methylpyrrolo[1,2-a]pyrazine?
7-methylpyrrolo[1,2-a]pyrazine has a molecular weight of 132.17 g/mol, XLogP of 1.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylpyrrolo[1,2-a]pyrazine is sourced from PubChem (CID 45087516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).