About 6,7-dihydro-2H-pyrazino[1,2-a]pyrimidine
6,7-dihydro-2H-pyrazino[1,2-a]pyrimidine (PubChem CID 45087621) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is 6,7-dihydro-2H-pyrazino[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | 6,7-dihydro-2H-pyrazino[1,2-a]pyrimidine |
| PubChem CID | 45087621 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 6,7-dihydro-2H-pyrazino[1,2-a]pyrimidine |
| SMILES | C1=CN2CCN=CC2=NC1 |
| InChI | InChI=1S/C7H9N3/c1-2-9-7-6-8-3-5-10(7)4-1/h1,4,6H,2-3,5H2 |
| InChIKey | XPCJOPHZGYWBMY-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dihydro-2H-pyrazino[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-2H-pyrazino[1,2-a]pyrimidine?
The IUPAC name of 6,7-dihydro-2H-pyrazino[1,2-a]pyrimidine (CID 45087621) is 6,7-dihydro-2H-pyrazino[1,2-a]pyrimidine.
What is the SMILES notation for 6,7-dihydro-2H-pyrazino[1,2-a]pyrimidine?
The canonical SMILES for 6,7-dihydro-2H-pyrazino[1,2-a]pyrimidine is C1=CN2CCN=CC2=NC1.
What is the InChIKey of 6,7-dihydro-2H-pyrazino[1,2-a]pyrimidine?
The InChIKey is XPCJOPHZGYWBMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3/c1-2-9-7-6-8-3-5-10(7)4-1/h1,4,6H,2-3,5H2.
What are the key properties of 6,7-dihydro-2H-pyrazino[1,2-a]pyrimidine?
6,7-dihydro-2H-pyrazino[1,2-a]pyrimidine has a molecular weight of 135.17 g/mol, XLogP of 0.30, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-2H-pyrazino[1,2-a]pyrimidine is sourced from PubChem (CID 45087621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).