About (8aS)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one
(8aS)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one (PubChem CID 45087810) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is (8aS)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one.
Analyze (8aS)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8aS)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one?
The IUPAC name of (8aS)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one (CID 45087810) is (8aS)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one.
What is the SMILES notation for (8aS)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one?
The canonical SMILES for (8aS)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one is O=C1CCN2CCC[C@H]2C1.
What is the InChIKey of (8aS)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one?
The InChIKey is CQTKSBAHMPWPQD-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H13NO/c10-8-3-5-9-4-1-2-7(9)6-8/h7H,1-6H2/t7-/m0/s1.
What are the key properties of (8aS)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one?
(8aS)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one has a molecular weight of 139.20 g/mol, XLogP of 0.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (8aS)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one is sourced from PubChem (CID 45087810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).