About 1-butan-2-yl-4,5-dihydroimidazol-2-amine
1-butan-2-yl-4,5-dihydroimidazol-2-amine (PubChem CID 45087867) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is 1-butan-2-yl-4,5-dihydroimidazol-2-amine.
Molecular Properties
| Compound Name | 1-butan-2-yl-4,5-dihydroimidazol-2-amine |
| PubChem CID | 45087867 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | 1-butan-2-yl-4,5-dihydroimidazol-2-amine |
| SMILES | CCC(C)N1CCN=C1N |
| InChI | InChI=1S/C7H15N3/c1-3-6(2)10-5-4-9-7(10)8/h6H,3-5H2,1-2H3,(H2,8,9) |
| InChIKey | ZYWDKGWSADMARB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butan-2-yl-4,5-dihydroimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-4,5-dihydroimidazol-2-amine?
The IUPAC name of 1-butan-2-yl-4,5-dihydroimidazol-2-amine (CID 45087867) is 1-butan-2-yl-4,5-dihydroimidazol-2-amine.
What is the SMILES notation for 1-butan-2-yl-4,5-dihydroimidazol-2-amine?
The canonical SMILES for 1-butan-2-yl-4,5-dihydroimidazol-2-amine is CCC(C)N1CCN=C1N.
What is the InChIKey of 1-butan-2-yl-4,5-dihydroimidazol-2-amine?
The InChIKey is ZYWDKGWSADMARB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3/c1-3-6(2)10-5-4-9-7(10)8/h6H,3-5H2,1-2H3,(H2,8,9).
What are the key properties of 1-butan-2-yl-4,5-dihydroimidazol-2-amine?
1-butan-2-yl-4,5-dihydroimidazol-2-amine has a molecular weight of 141.22 g/mol, XLogP of 0.42, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-4,5-dihydroimidazol-2-amine is sourced from PubChem (CID 45087867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).