About 2,6-diazatricyclo[6.2.1.02,7]undeca-1(10),3,6,8-tetraene
2,6-diazatricyclo[6.2.1.02,7]undeca-1(10),3,6,8-tetraene (PubChem CID 45088024) has the molecular formula C9H8N2
and a molecular weight of 144.18 g/mol. Its IUPAC name is 2,6-diazatricyclo[6.2.1.02,7]undeca-1(10),3,6,8-tetraene.
Analyze 2,6-diazatricyclo[6.2.1.02,7]undeca-1(10),3,6,8-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diazatricyclo[6.2.1.02,7]undeca-1(10),3,6,8-tetraene?
The IUPAC name of 2,6-diazatricyclo[6.2.1.02,7]undeca-1(10),3,6,8-tetraene (CID 45088024) is 2,6-diazatricyclo[6.2.1.02,7]undeca-1(10),3,6,8-tetraene.
What is the SMILES notation for 2,6-diazatricyclo[6.2.1.02,7]undeca-1(10),3,6,8-tetraene?
The canonical SMILES for 2,6-diazatricyclo[6.2.1.02,7]undeca-1(10),3,6,8-tetraene is C1=CN2C3=CC=C(C3)C2=NC1.
What is the InChIKey of 2,6-diazatricyclo[6.2.1.02,7]undeca-1(10),3,6,8-tetraene?
The InChIKey is AIWUGKLTYFFASJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2/c1-4-10-9-7-2-3-8(6-7)11(9)5-1/h1-3,5H,4,6H2.
What are the key properties of 2,6-diazatricyclo[6.2.1.02,7]undeca-1(10),3,6,8-tetraene?
2,6-diazatricyclo[6.2.1.02,7]undeca-1(10),3,6,8-tetraene has a molecular weight of 144.18 g/mol, XLogP of 1.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diazatricyclo[6.2.1.02,7]undeca-1(10),3,6,8-tetraene is sourced from PubChem (CID 45088024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).