About 5-hydroxy-3-methyl-1,3-thiazinan-2-one
5-hydroxy-3-methyl-1,3-thiazinan-2-one (PubChem CID 45088173) has the molecular formula C5H9NO2S
and a molecular weight of 147.20 g/mol. Its IUPAC name is 5-hydroxy-3-methyl-1,3-thiazinan-2-one.
Molecular Properties
| Compound Name | 5-hydroxy-3-methyl-1,3-thiazinan-2-one |
| PubChem CID | 45088173 |
| Molecular Formula | C5H9NO2S |
| Molecular Weight | 147.20 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | 5-hydroxy-3-methyl-1,3-thiazinan-2-one |
| SMILES | CN1CC(O)CSC1=O |
| InChI | InChI=1S/C5H9NO2S/c1-6-2-4(7)3-9-5(6)8/h4,7H,2-3H2,1H3 |
| InChIKey | VJZDSXLYLUGACC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.20 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-3-methyl-1,3-thiazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-3-methyl-1,3-thiazinan-2-one?
The IUPAC name of 5-hydroxy-3-methyl-1,3-thiazinan-2-one (CID 45088173) is 5-hydroxy-3-methyl-1,3-thiazinan-2-one.
What is the SMILES notation for 5-hydroxy-3-methyl-1,3-thiazinan-2-one?
The canonical SMILES for 5-hydroxy-3-methyl-1,3-thiazinan-2-one is CN1CC(O)CSC1=O.
What is the InChIKey of 5-hydroxy-3-methyl-1,3-thiazinan-2-one?
The InChIKey is VJZDSXLYLUGACC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2S/c1-6-2-4(7)3-9-5(6)8/h4,7H,2-3H2,1H3.
What are the key properties of 5-hydroxy-3-methyl-1,3-thiazinan-2-one?
5-hydroxy-3-methyl-1,3-thiazinan-2-one has a molecular weight of 147.20 g/mol, XLogP of 0.15, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-3-methyl-1,3-thiazinan-2-one is sourced from PubChem (CID 45088173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).