About (1S,5R,6R,7R)-3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile
(1S,5R,6R,7R)-3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile (PubChem CID 45088205) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is (1S,5R,6R,7R)-3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile.
Analyze (1S,5R,6R,7R)-3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R,6R,7R)-3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile?
The IUPAC name of (1S,5R,6R,7R)-3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile (CID 45088205) is (1S,5R,6R,7R)-3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile.
What is the SMILES notation for (1S,5R,6R,7R)-3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile?
The canonical SMILES for (1S,5R,6R,7R)-3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile is N#C[C@@H]1[C@H]2C[C@H]3C[C@H]1N(C3)C2.
What is the InChIKey of (1S,5R,6R,7R)-3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile?
The InChIKey is BAIOZIDJWYMNJS-RBXMUDONSA-N. The full InChI is InChI=1S/C9H12N2/c10-3-8-7-1-6-2-9(8)11(4-6)5-7/h6-9H,1-2,4-5H2/t6-,7-,8+,9+/m0/s1.
What are the key properties of (1S,5R,6R,7R)-3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile?
(1S,5R,6R,7R)-3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile has a molecular weight of 148.21 g/mol, XLogP of 0.85, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R,6R,7R)-3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile is sourced from PubChem (CID 45088205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).