About [(5S)-5,6-dihydroindolizin-5-yl]methanol
[(5S)-5,6-dihydroindolizin-5-yl]methanol (PubChem CID 45088225) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is [(5S)-5,6-dihydroindolizin-5-yl]methanol.
Molecular Properties
| Compound Name | [(5S)-5,6-dihydroindolizin-5-yl]methanol |
| PubChem CID | 45088225 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | [(5S)-5,6-dihydroindolizin-5-yl]methanol |
| SMILES | OC[C@@H]1CC=Cc2cccn21 |
| InChI | InChI=1S/C9H11NO/c11-7-9-4-1-3-8-5-2-6-10(8)9/h1-3,5-6,9,11H,4,7H2/t9-/m0/s1 |
| InChIKey | RDJCVWHWWOWDGF-VIFPVBQESA-N |
| XLogP | 1.44 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(5S)-5,6-dihydroindolizin-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S)-5,6-dihydroindolizin-5-yl]methanol?
The IUPAC name of [(5S)-5,6-dihydroindolizin-5-yl]methanol (CID 45088225) is [(5S)-5,6-dihydroindolizin-5-yl]methanol.
What is the SMILES notation for [(5S)-5,6-dihydroindolizin-5-yl]methanol?
The canonical SMILES for [(5S)-5,6-dihydroindolizin-5-yl]methanol is OC[C@@H]1CC=Cc2cccn21.
What is the InChIKey of [(5S)-5,6-dihydroindolizin-5-yl]methanol?
The InChIKey is RDJCVWHWWOWDGF-VIFPVBQESA-N. The full InChI is InChI=1S/C9H11NO/c11-7-9-4-1-3-8-5-2-6-10(8)9/h1-3,5-6,9,11H,4,7H2/t9-/m0/s1.
What are the key properties of [(5S)-5,6-dihydroindolizin-5-yl]methanol?
[(5S)-5,6-dihydroindolizin-5-yl]methanol has a molecular weight of 149.19 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S)-5,6-dihydroindolizin-5-yl]methanol is sourced from PubChem (CID 45088225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).