C7H12N4 — CID 45088326
4-(1,2,4-triazol-4-yl)piperidine (PubChem CID 45088326) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is 4-(1,2,4-triazol-4-yl)piperidine.
| Compound Name | 4-(1,2,4-triazol-4-yl)piperidine |
|---|---|
| PubChem CID | 45088326 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 4-(1,2,4-triazol-4-yl)piperidine |
| SMILES | c1nncn1C1CCNCC1 |
| InChI | InChI=1S/C7H12N4/c1-3-8-4-2-7(1)11-5-9-10-6-11/h5-8H,1-4H2 |
| InChIKey | OQHDZWPNEOFLCW-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |