About 1-(1-ethylpyrrol-2-yl)-N,N-dimethylmethanamine
1-(1-ethylpyrrol-2-yl)-N,N-dimethylmethanamine (PubChem CID 45088335) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-(1-ethylpyrrol-2-yl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(1-ethylpyrrol-2-yl)-N,N-dimethylmethanamine |
| PubChem CID | 45088335 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1-(1-ethylpyrrol-2-yl)-N,N-dimethylmethanamine |
| SMILES | CCn1cccc1CN(C)C |
| InChI | InChI=1S/C9H16N2/c1-4-11-7-5-6-9(11)8-10(2)3/h5-7H,4,8H2,1-3H3 |
| InChIKey | JFBHVEAHHRQQJL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-ethylpyrrol-2-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-ethylpyrrol-2-yl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(1-ethylpyrrol-2-yl)-N,N-dimethylmethanamine (CID 45088335) is 1-(1-ethylpyrrol-2-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(1-ethylpyrrol-2-yl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(1-ethylpyrrol-2-yl)-N,N-dimethylmethanamine is CCn1cccc1CN(C)C.
What is the InChIKey of 1-(1-ethylpyrrol-2-yl)-N,N-dimethylmethanamine?
The InChIKey is JFBHVEAHHRQQJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-4-11-7-5-6-9(11)8-10(2)3/h5-7H,4,8H2,1-3H3.
What are the key properties of 1-(1-ethylpyrrol-2-yl)-N,N-dimethylmethanamine?
1-(1-ethylpyrrol-2-yl)-N,N-dimethylmethanamine has a molecular weight of 152.24 g/mol, XLogP of 1.57, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-ethylpyrrol-2-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 45088335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).