About 1-butyl-4-methyl-4,5-dihydroimidazol-2-amine
1-butyl-4-methyl-4,5-dihydroimidazol-2-amine (PubChem CID 45088430) has the molecular formula C8H17N3
and a molecular weight of 155.24 g/mol. Its IUPAC name is 1-butyl-4-methyl-4,5-dihydroimidazol-2-amine.
Molecular Properties
| Compound Name | 1-butyl-4-methyl-4,5-dihydroimidazol-2-amine |
| PubChem CID | 45088430 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 1-butyl-4-methyl-4,5-dihydroimidazol-2-amine |
| SMILES | CCCCN1CC(C)N=C1N |
| InChI | InChI=1S/C8H17N3/c1-3-4-5-11-6-7(2)10-8(11)9/h7H,3-6H2,1-2H3,(H2,9,10) |
| InChIKey | HZBFAZIHTGREPP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butyl-4-methyl-4,5-dihydroimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-methyl-4,5-dihydroimidazol-2-amine?
The IUPAC name of 1-butyl-4-methyl-4,5-dihydroimidazol-2-amine (CID 45088430) is 1-butyl-4-methyl-4,5-dihydroimidazol-2-amine.
What is the SMILES notation for 1-butyl-4-methyl-4,5-dihydroimidazol-2-amine?
The canonical SMILES for 1-butyl-4-methyl-4,5-dihydroimidazol-2-amine is CCCCN1CC(C)N=C1N.
What is the InChIKey of 1-butyl-4-methyl-4,5-dihydroimidazol-2-amine?
The InChIKey is HZBFAZIHTGREPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3/c1-3-4-5-11-6-7(2)10-8(11)9/h7H,3-6H2,1-2H3,(H2,9,10).
What are the key properties of 1-butyl-4-methyl-4,5-dihydroimidazol-2-amine?
1-butyl-4-methyl-4,5-dihydroimidazol-2-amine has a molecular weight of 155.24 g/mol, XLogP of 0.81, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-methyl-4,5-dihydroimidazol-2-amine is sourced from PubChem (CID 45088430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).