About (3R,5S)-3,5-dimethylpiperazine-1-carboximidamide
(3R,5S)-3,5-dimethylpiperazine-1-carboximidamide (PubChem CID 45088464) has the molecular formula C7H16N4
and a molecular weight of 156.23 g/mol. Its IUPAC name is (3R,5S)-3,5-dimethylpiperazine-1-carboximidamide.
Molecular Properties
| Compound Name | (3R,5S)-3,5-dimethylpiperazine-1-carboximidamide |
| PubChem CID | 45088464 |
| Molecular Formula | C7H16N4 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.14 |
| IUPAC Name | (3R,5S)-3,5-dimethylpiperazine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1C[C@@H](C)N[C@@H](C)C1 |
| InChI | InChI=1S/C7H16N4/c1-5-3-11(7(8)9)4-6(2)10-5/h5-6,10H,3-4H2,1-2H3,(H3,8,9)/t5-,6+ |
| InChIKey | ODGSIRUOMGFREO-OLQVQODUSA-N |
| XLogP | -0.44 |
| TPSA | 65.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (3R,5S)-3,5-dimethylpiperazine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-3,5-dimethylpiperazine-1-carboximidamide?
The IUPAC name of (3R,5S)-3,5-dimethylpiperazine-1-carboximidamide (CID 45088464) is (3R,5S)-3,5-dimethylpiperazine-1-carboximidamide.
What is the SMILES notation for (3R,5S)-3,5-dimethylpiperazine-1-carboximidamide?
The canonical SMILES for (3R,5S)-3,5-dimethylpiperazine-1-carboximidamide is [H]/N=C(\N)N1C[C@@H](C)N[C@@H](C)C1.
What is the InChIKey of (3R,5S)-3,5-dimethylpiperazine-1-carboximidamide?
The InChIKey is ODGSIRUOMGFREO-OLQVQODUSA-N. The full InChI is InChI=1S/C7H16N4/c1-5-3-11(7(8)9)4-6(2)10-5/h5-6,10H,3-4H2,1-2H3,(H3,8,9)/t5-,6+.
What are the key properties of (3R,5S)-3,5-dimethylpiperazine-1-carboximidamide?
(3R,5S)-3,5-dimethylpiperazine-1-carboximidamide has a molecular weight of 156.23 g/mol, XLogP of -0.44, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-3,5-dimethylpiperazine-1-carboximidamide is sourced from PubChem (CID 45088464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).