About 1-methylpiperazine-2,5-dithione
1-methylpiperazine-2,5-dithione (PubChem CID 45088649) has the molecular formula C5H8N2S2
and a molecular weight of 160.27 g/mol. Its IUPAC name is 1-methylpiperazine-2,5-dithione.
Molecular Properties
| Compound Name | 1-methylpiperazine-2,5-dithione |
| PubChem CID | 45088649 |
| Molecular Formula | C5H8N2S2 |
| Molecular Weight | 160.27 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | 1-methylpiperazine-2,5-dithione |
| SMILES | CN1CC(=S)NCC1=S |
| InChI | InChI=1S/C5H8N2S2/c1-7-3-4(8)6-2-5(7)9/h2-3H2,1H3,(H,6,8) |
| InChIKey | FDZWMYJTOZCXPO-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpiperazine-2,5-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperazine-2,5-dithione?
The IUPAC name of 1-methylpiperazine-2,5-dithione (CID 45088649) is 1-methylpiperazine-2,5-dithione.
What is the SMILES notation for 1-methylpiperazine-2,5-dithione?
The canonical SMILES for 1-methylpiperazine-2,5-dithione is CN1CC(=S)NCC1=S.
What is the InChIKey of 1-methylpiperazine-2,5-dithione?
The InChIKey is FDZWMYJTOZCXPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2S2/c1-7-3-4(8)6-2-5(7)9/h2-3H2,1H3,(H,6,8).
What are the key properties of 1-methylpiperazine-2,5-dithione?
1-methylpiperazine-2,5-dithione has a molecular weight of 160.27 g/mol, XLogP of 0.18, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperazine-2,5-dithione is sourced from PubChem (CID 45088649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).