About 3-(3-methoxypropyl)-1,1-dimethylurea
3-(3-methoxypropyl)-1,1-dimethylurea (PubChem CID 45088657) has the molecular formula C7H16N2O2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-(3-methoxypropyl)-1,1-dimethylurea |
| PubChem CID | 45088657 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | 3-(3-methoxypropyl)-1,1-dimethylurea |
| SMILES | COCCCNC(=O)N(C)C |
| InChI | InChI=1S/C7H16N2O2/c1-9(2)7(10)8-5-4-6-11-3/h4-6H2,1-3H3,(H,8,10) |
| InChIKey | ATHYVSLPGNFXND-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-methoxypropyl)-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methoxypropyl)-1,1-dimethylurea?
The IUPAC name of 3-(3-methoxypropyl)-1,1-dimethylurea (CID 45088657) is 3-(3-methoxypropyl)-1,1-dimethylurea.
What is the SMILES notation for 3-(3-methoxypropyl)-1,1-dimethylurea?
The canonical SMILES for 3-(3-methoxypropyl)-1,1-dimethylurea is COCCCNC(=O)N(C)C.
What is the InChIKey of 3-(3-methoxypropyl)-1,1-dimethylurea?
The InChIKey is ATHYVSLPGNFXND-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O2/c1-9(2)7(10)8-5-4-6-11-3/h4-6H2,1-3H3,(H,8,10).
What are the key properties of 3-(3-methoxypropyl)-1,1-dimethylurea?
3-(3-methoxypropyl)-1,1-dimethylurea has a molecular weight of 160.22 g/mol, XLogP of 0.29, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methoxypropyl)-1,1-dimethylurea is sourced from PubChem (CID 45088657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).