About 1-cyclopenta-2,4-dien-1-ylidene-N,N-diethylethanamine
1-cyclopenta-2,4-dien-1-ylidene-N,N-diethylethanamine (PubChem CID 45088785) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylidene-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 1-cyclopenta-2,4-dien-1-ylidene-N,N-diethylethanamine |
| PubChem CID | 45088785 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylidene-N,N-diethylethanamine |
| SMILES | CCN(CC)C(C)=C1C=CC=C1 |
| InChI | InChI=1S/C11H17N/c1-4-12(5-2)10(3)11-8-6-7-9-11/h6-9H,4-5H2,1-3H3 |
| InChIKey | CNKWVIQDOJCKJJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopenta-2,4-dien-1-ylidene-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-2,4-dien-1-ylidene-N,N-diethylethanamine?
The IUPAC name of 1-cyclopenta-2,4-dien-1-ylidene-N,N-diethylethanamine (CID 45088785) is 1-cyclopenta-2,4-dien-1-ylidene-N,N-diethylethanamine.
What is the SMILES notation for 1-cyclopenta-2,4-dien-1-ylidene-N,N-diethylethanamine?
The canonical SMILES for 1-cyclopenta-2,4-dien-1-ylidene-N,N-diethylethanamine is CCN(CC)C(C)=C1C=CC=C1.
What is the InChIKey of 1-cyclopenta-2,4-dien-1-ylidene-N,N-diethylethanamine?
The InChIKey is CNKWVIQDOJCKJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-4-12(5-2)10(3)11-8-6-7-9-11/h6-9H,4-5H2,1-3H3.
What are the key properties of 1-cyclopenta-2,4-dien-1-ylidene-N,N-diethylethanamine?
1-cyclopenta-2,4-dien-1-ylidene-N,N-diethylethanamine has a molecular weight of 163.26 g/mol, XLogP of 2.73, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-2,4-dien-1-ylidene-N,N-diethylethanamine is sourced from PubChem (CID 45088785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).