C10H13NO — CID 45088796
9-methyl-2,3,6,7-tetrahydroquinolizin-4-one (PubChem CID 45088796) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 9-methyl-2,3,6,7-tetrahydroquinolizin-4-one.
| Compound Name | 9-methyl-2,3,6,7-tetrahydroquinolizin-4-one |
|---|---|
| PubChem CID | 45088796 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 9-methyl-2,3,6,7-tetrahydroquinolizin-4-one |
| SMILES | CC1=CCCN2C(=O)CCC=C12 |
| InChI | InChI=1S/C10H13NO/c1-8-4-3-7-11-9(8)5-2-6-10(11)12/h4-5H,2-3,6-7H2,1H3 |
| InChIKey | BLNXZFIYCFOHQR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |