About 3-[(2S)-1-methylpyrrolidin-2-yl]-1,2-dihydropyridine
3-[(2S)-1-methylpyrrolidin-2-yl]-1,2-dihydropyridine (PubChem CID 45088834) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is 3-[(2S)-1-methylpyrrolidin-2-yl]-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 3-[(2S)-1-methylpyrrolidin-2-yl]-1,2-dihydropyridine |
| PubChem CID | 45088834 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 3-[(2S)-1-methylpyrrolidin-2-yl]-1,2-dihydropyridine |
| SMILES | CN1CCC[C@H]1C1=CC=CNC1 |
| InChI | InChI=1S/C10H16N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,4,6,10-11H,3,5,7-8H2,1H3/t10-/m0/s1 |
| InChIKey | ALAFLZBTERPAMD-JTQLQIEISA-N |
| XLogP | 1.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(2S)-1-methylpyrrolidin-2-yl]-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S)-1-methylpyrrolidin-2-yl]-1,2-dihydropyridine?
The IUPAC name of 3-[(2S)-1-methylpyrrolidin-2-yl]-1,2-dihydropyridine (CID 45088834) is 3-[(2S)-1-methylpyrrolidin-2-yl]-1,2-dihydropyridine.
What is the SMILES notation for 3-[(2S)-1-methylpyrrolidin-2-yl]-1,2-dihydropyridine?
The canonical SMILES for 3-[(2S)-1-methylpyrrolidin-2-yl]-1,2-dihydropyridine is CN1CCC[C@H]1C1=CC=CNC1.
What is the InChIKey of 3-[(2S)-1-methylpyrrolidin-2-yl]-1,2-dihydropyridine?
The InChIKey is ALAFLZBTERPAMD-JTQLQIEISA-N. The full InChI is InChI=1S/C10H16N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,4,6,10-11H,3,5,7-8H2,1H3/t10-/m0/s1.
What are the key properties of 3-[(2S)-1-methylpyrrolidin-2-yl]-1,2-dihydropyridine?
3-[(2S)-1-methylpyrrolidin-2-yl]-1,2-dihydropyridine has a molecular weight of 164.25 g/mol, XLogP of 1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S)-1-methylpyrrolidin-2-yl]-1,2-dihydropyridine is sourced from PubChem (CID 45088834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).