C10H15NO — CID 45088850
6,6-dimethyl-1,2,3,7-tetrahydroindolizin-5-one (PubChem CID 45088850) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 6,6-dimethyl-1,2,3,7-tetrahydroindolizin-5-one.
| Compound Name | 6,6-dimethyl-1,2,3,7-tetrahydroindolizin-5-one |
|---|---|
| PubChem CID | 45088850 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 6,6-dimethyl-1,2,3,7-tetrahydroindolizin-5-one |
| SMILES | CC1(C)CC=C2CCCN2C1=O |
| InChI | InChI=1S/C10H15NO/c1-10(2)6-5-8-4-3-7-11(8)9(10)12/h5H,3-4,6-7H2,1-2H3 |
| InChIKey | LAOUBTGJQBNDSG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |