About 1-(1H-pyrazol-5-yl)-1,3-diazinan-2-one
1-(1H-pyrazol-5-yl)-1,3-diazinan-2-one (PubChem CID 45088881) has the molecular formula C7H10N4O
and a molecular weight of 166.18 g/mol. Its IUPAC name is 1-(1H-pyrazol-5-yl)-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1-(1H-pyrazol-5-yl)-1,3-diazinan-2-one |
| PubChem CID | 45088881 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 1-(1H-pyrazol-5-yl)-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1c1ccn[nH]1 |
| InChI | InChI=1S/C7H10N4O/c12-7-8-3-1-5-11(7)6-2-4-9-10-6/h2,4H,1,3,5H2,(H,8,12)(H,9,10) |
| InChIKey | CNSWEYOPMNZRMW-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1H-pyrazol-5-yl)-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-pyrazol-5-yl)-1,3-diazinan-2-one?
The IUPAC name of 1-(1H-pyrazol-5-yl)-1,3-diazinan-2-one (CID 45088881) is 1-(1H-pyrazol-5-yl)-1,3-diazinan-2-one.
What is the SMILES notation for 1-(1H-pyrazol-5-yl)-1,3-diazinan-2-one?
The canonical SMILES for 1-(1H-pyrazol-5-yl)-1,3-diazinan-2-one is O=C1NCCCN1c1ccn[nH]1.
What is the InChIKey of 1-(1H-pyrazol-5-yl)-1,3-diazinan-2-one?
The InChIKey is CNSWEYOPMNZRMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O/c12-7-8-3-1-5-11(7)6-2-4-9-10-6/h2,4H,1,3,5H2,(H,8,12)(H,9,10).
What are the key properties of 1-(1H-pyrazol-5-yl)-1,3-diazinan-2-one?
1-(1H-pyrazol-5-yl)-1,3-diazinan-2-one has a molecular weight of 166.18 g/mol, XLogP of 0.33, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-pyrazol-5-yl)-1,3-diazinan-2-one is sourced from PubChem (CID 45088881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).