About 1-butyl-5-ethyl-4,5-dihydroimidazol-2-amine
1-butyl-5-ethyl-4,5-dihydroimidazol-2-amine (PubChem CID 45089042) has the molecular formula C9H19N3
and a molecular weight of 169.27 g/mol. Its IUPAC name is 1-butyl-5-ethyl-4,5-dihydroimidazol-2-amine.
Molecular Properties
| Compound Name | 1-butyl-5-ethyl-4,5-dihydroimidazol-2-amine |
| PubChem CID | 45089042 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | 1-butyl-5-ethyl-4,5-dihydroimidazol-2-amine |
| SMILES | CCCCN1C(N)=NCC1CC |
| InChI | InChI=1S/C9H19N3/c1-3-5-6-12-8(4-2)7-11-9(12)10/h8H,3-7H2,1-2H3,(H2,10,11) |
| InChIKey | CUCVUNVVSUIDKK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butyl-5-ethyl-4,5-dihydroimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-5-ethyl-4,5-dihydroimidazol-2-amine?
The IUPAC name of 1-butyl-5-ethyl-4,5-dihydroimidazol-2-amine (CID 45089042) is 1-butyl-5-ethyl-4,5-dihydroimidazol-2-amine.
What is the SMILES notation for 1-butyl-5-ethyl-4,5-dihydroimidazol-2-amine?
The canonical SMILES for 1-butyl-5-ethyl-4,5-dihydroimidazol-2-amine is CCCCN1C(N)=NCC1CC.
What is the InChIKey of 1-butyl-5-ethyl-4,5-dihydroimidazol-2-amine?
The InChIKey is CUCVUNVVSUIDKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3/c1-3-5-6-12-8(4-2)7-11-9(12)10/h8H,3-7H2,1-2H3,(H2,10,11).
What are the key properties of 1-butyl-5-ethyl-4,5-dihydroimidazol-2-amine?
1-butyl-5-ethyl-4,5-dihydroimidazol-2-amine has a molecular weight of 169.27 g/mol, XLogP of 1.20, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-5-ethyl-4,5-dihydroimidazol-2-amine is sourced from PubChem (CID 45089042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).