About 4-aminocyclohexa-1,5-diene-1-carboxylic acid
4-aminocyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 45089103) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 4-aminocyclohexa-1,5-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-aminocyclohexa-1,5-diene-1-carboxylic acid |
| PubChem CID | 45089103 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 4-aminocyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | NC1C=CC(C(=O)O)=CC1 |
| InChI | InChI=1S/C7H9NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-3,6H,4,8H2,(H,9,10) |
| InChIKey | JBKQFPCCYZNWCP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-aminocyclohexa-1,5-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminocyclohexa-1,5-diene-1-carboxylic acid?
The IUPAC name of 4-aminocyclohexa-1,5-diene-1-carboxylic acid (CID 45089103) is 4-aminocyclohexa-1,5-diene-1-carboxylic acid.
What is the SMILES notation for 4-aminocyclohexa-1,5-diene-1-carboxylic acid?
The canonical SMILES for 4-aminocyclohexa-1,5-diene-1-carboxylic acid is NC1C=CC(C(=O)O)=CC1.
What is the InChIKey of 4-aminocyclohexa-1,5-diene-1-carboxylic acid?
The InChIKey is JBKQFPCCYZNWCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-3,6H,4,8H2,(H,9,10).
What are the key properties of 4-aminocyclohexa-1,5-diene-1-carboxylic acid?
4-aminocyclohexa-1,5-diene-1-carboxylic acid has a molecular weight of 139.15 g/mol, XLogP of 0.28, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminocyclohexa-1,5-diene-1-carboxylic acid is sourced from PubChem (CID 45089103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).