About tert-butyl 2-amino-5,6-dihydro-4H-pyrimidine-1-carboxylate
tert-butyl 2-amino-5,6-dihydro-4H-pyrimidine-1-carboxylate (PubChem CID 45089505) has the molecular formula C9H17N3O2
and a molecular weight of 199.25 g/mol. Its IUPAC name is tert-butyl 2-amino-5,6-dihydro-4H-pyrimidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-amino-5,6-dihydro-4H-pyrimidine-1-carboxylate |
| PubChem CID | 45089505 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | tert-butyl 2-amino-5,6-dihydro-4H-pyrimidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN=C1N |
| InChI | InChI=1S/C9H17N3O2/c1-9(2,3)14-8(13)12-6-4-5-11-7(12)10/h4-6H2,1-3H3,(H2,10,11) |
| InChIKey | DITMMUXXWXWCJU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 2-amino-5,6-dihydro-4H-pyrimidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-amino-5,6-dihydro-4H-pyrimidine-1-carboxylate?
The IUPAC name of tert-butyl 2-amino-5,6-dihydro-4H-pyrimidine-1-carboxylate (CID 45089505) is tert-butyl 2-amino-5,6-dihydro-4H-pyrimidine-1-carboxylate.
What is the SMILES notation for tert-butyl 2-amino-5,6-dihydro-4H-pyrimidine-1-carboxylate?
The canonical SMILES for tert-butyl 2-amino-5,6-dihydro-4H-pyrimidine-1-carboxylate is CC(C)(C)OC(=O)N1CCCN=C1N.
What is the InChIKey of tert-butyl 2-amino-5,6-dihydro-4H-pyrimidine-1-carboxylate?
The InChIKey is DITMMUXXWXWCJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O2/c1-9(2,3)14-8(13)12-6-4-5-11-7(12)10/h4-6H2,1-3H3,(H2,10,11).
What are the key properties of tert-butyl 2-amino-5,6-dihydro-4H-pyrimidine-1-carboxylate?
tert-butyl 2-amino-5,6-dihydro-4H-pyrimidine-1-carboxylate has a molecular weight of 199.25 g/mol, XLogP of 0.94, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-amino-5,6-dihydro-4H-pyrimidine-1-carboxylate is sourced from PubChem (CID 45089505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).