About methyl 4-amino-3-carbamoyl-1,2-thiazole-5-carboxylate
methyl 4-amino-3-carbamoyl-1,2-thiazole-5-carboxylate (PubChem CID 45089589) has the molecular formula C6H7N3O3S
and a molecular weight of 201.21 g/mol. Its IUPAC name is methyl 4-amino-3-carbamoyl-1,2-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 4-amino-3-carbamoyl-1,2-thiazole-5-carboxylate |
| PubChem CID | 45089589 |
| Molecular Formula | C6H7N3O3S |
| Molecular Weight | 201.21 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | methyl 4-amino-3-carbamoyl-1,2-thiazole-5-carboxylate |
| SMILES | COC(=O)c1snc(C(N)=O)c1N |
| InChI | InChI=1S/C6H7N3O3S/c1-12-6(11)4-2(7)3(5(8)10)9-13-4/h7H2,1H3,(H2,8,10) |
| InChIKey | IBUBKEKAWFVXMI-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.21 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-amino-3-carbamoyl-1,2-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-3-carbamoyl-1,2-thiazole-5-carboxylate?
The IUPAC name of methyl 4-amino-3-carbamoyl-1,2-thiazole-5-carboxylate (CID 45089589) is methyl 4-amino-3-carbamoyl-1,2-thiazole-5-carboxylate.
What is the SMILES notation for methyl 4-amino-3-carbamoyl-1,2-thiazole-5-carboxylate?
The canonical SMILES for methyl 4-amino-3-carbamoyl-1,2-thiazole-5-carboxylate is COC(=O)c1snc(C(N)=O)c1N.
What is the InChIKey of methyl 4-amino-3-carbamoyl-1,2-thiazole-5-carboxylate?
The InChIKey is IBUBKEKAWFVXMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O3S/c1-12-6(11)4-2(7)3(5(8)10)9-13-4/h7H2,1H3,(H2,8,10).
What are the key properties of methyl 4-amino-3-carbamoyl-1,2-thiazole-5-carboxylate?
methyl 4-amino-3-carbamoyl-1,2-thiazole-5-carboxylate has a molecular weight of 201.21 g/mol, XLogP of -0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-3-carbamoyl-1,2-thiazole-5-carboxylate is sourced from PubChem (CID 45089589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).