About methyl 2-methyl-2,5-dihydropyrrole-1-carboxylate
methyl 2-methyl-2,5-dihydropyrrole-1-carboxylate (PubChem CID 45089938) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is methyl 2-methyl-2,5-dihydropyrrole-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2-methyl-2,5-dihydropyrrole-1-carboxylate |
| PubChem CID | 45089938 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | methyl 2-methyl-2,5-dihydropyrrole-1-carboxylate |
| SMILES | COC(=O)N1CC=CC1C |
| InChI | InChI=1S/C7H11NO2/c1-6-4-3-5-8(6)7(9)10-2/h3-4,6H,5H2,1-2H3 |
| InChIKey | SVGNUUWIBTUTHE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methyl-2,5-dihydropyrrole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyl-2,5-dihydropyrrole-1-carboxylate?
The IUPAC name of methyl 2-methyl-2,5-dihydropyrrole-1-carboxylate (CID 45089938) is methyl 2-methyl-2,5-dihydropyrrole-1-carboxylate.
What is the SMILES notation for methyl 2-methyl-2,5-dihydropyrrole-1-carboxylate?
The canonical SMILES for methyl 2-methyl-2,5-dihydropyrrole-1-carboxylate is COC(=O)N1CC=CC1C.
What is the InChIKey of methyl 2-methyl-2,5-dihydropyrrole-1-carboxylate?
The InChIKey is SVGNUUWIBTUTHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-6-4-3-5-8(6)7(9)10-2/h3-4,6H,5H2,1-2H3.
What are the key properties of methyl 2-methyl-2,5-dihydropyrrole-1-carboxylate?
methyl 2-methyl-2,5-dihydropyrrole-1-carboxylate has a molecular weight of 141.17 g/mol, XLogP of 1.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-2,5-dihydropyrrole-1-carboxylate is sourced from PubChem (CID 45089938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).