ethyl 3,4-dihydro-2H-pyrrole-4-carboxylate

C7H11NO2 — CID 45089954

IUPACethyl 3,4-dihydro-2H-pyrrole-4-carboxylate
SMILESCCOC(=O)C1C=NCC1
InChIInChI=1S/C7H11NO2/c1-2-10-7(9)6-3-4-8-5-6/h5-6H,2-4H2,1H3
InChIKeyYNAXGNQDDXYYPK-UHFFFAOYSA-N
MW141.17 g/mol
LogP0.64
Rot. Bonds2

About ethyl 3,4-dihydro-2H-pyrrole-4-carboxylate

ethyl 3,4-dihydro-2H-pyrrole-4-carboxylate (PubChem CID 45089954) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is ethyl 3,4-dihydro-2H-pyrrole-4-carboxylate.

Molecular Properties

Compound Nameethyl 3,4-dihydro-2H-pyrrole-4-carboxylate
PubChem CID45089954
Molecular FormulaC7H11NO2
Molecular Weight141.17 g/mol
Exact Mass141.08
IUPAC Nameethyl 3,4-dihydro-2H-pyrrole-4-carboxylate
SMILESCCOC(=O)C1C=NCC1
InChIInChI=1S/C7H11NO2/c1-2-10-7(9)6-3-4-8-5-6/h5-6H,2-4H2,1H3
InChIKeyYNAXGNQDDXYYPK-UHFFFAOYSA-N
XLogP0.64
TPSA38.66 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.17
LogP ≤ 50.64
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze ethyl 3,4-dihydro-2H-pyrrole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3,4-dihydro-2H-pyrrole-4-carboxylate?
The IUPAC name of ethyl 3,4-dihydro-2H-pyrrole-4-carboxylate (CID 45089954) is ethyl 3,4-dihydro-2H-pyrrole-4-carboxylate.
What is the SMILES notation for ethyl 3,4-dihydro-2H-pyrrole-4-carboxylate?
The canonical SMILES for ethyl 3,4-dihydro-2H-pyrrole-4-carboxylate is CCOC(=O)C1C=NCC1.
What is the InChIKey of ethyl 3,4-dihydro-2H-pyrrole-4-carboxylate?
The InChIKey is YNAXGNQDDXYYPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-2-10-7(9)6-3-4-8-5-6/h5-6H,2-4H2,1H3.
What are the key properties of ethyl 3,4-dihydro-2H-pyrrole-4-carboxylate?
ethyl 3,4-dihydro-2H-pyrrole-4-carboxylate has a molecular weight of 141.17 g/mol, XLogP of 0.64, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3,4-dihydro-2H-pyrrole-4-carboxylate is sourced from PubChem (CID 45089954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).