About methyl oxepine-2-carboxylate
methyl oxepine-2-carboxylate (PubChem CID 45090123) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is methyl oxepine-2-carboxylate.
Molecular Properties
| Compound Name | methyl oxepine-2-carboxylate |
| PubChem CID | 45090123 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | methyl oxepine-2-carboxylate |
| SMILES | COC(=O)C1=CC=CC=CO1 |
| InChI | InChI=1S/C8H8O3/c1-10-8(9)7-5-3-2-4-6-11-7/h2-6H,1H3 |
| InChIKey | LGWGHIVCHVTBRS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl oxepine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl oxepine-2-carboxylate?
The IUPAC name of methyl oxepine-2-carboxylate (CID 45090123) is methyl oxepine-2-carboxylate.
What is the SMILES notation for methyl oxepine-2-carboxylate?
The canonical SMILES for methyl oxepine-2-carboxylate is COC(=O)C1=CC=CC=CO1.
What is the InChIKey of methyl oxepine-2-carboxylate?
The InChIKey is LGWGHIVCHVTBRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3/c1-10-8(9)7-5-3-2-4-6-11-7/h2-6H,1H3.
What are the key properties of methyl oxepine-2-carboxylate?
methyl oxepine-2-carboxylate has a molecular weight of 152.15 g/mol, XLogP of 1.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl oxepine-2-carboxylate is sourced from PubChem (CID 45090123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).