About N,N,2-trifluoro-2,3-dihydropyridin-4-amine
N,N,2-trifluoro-2,3-dihydropyridin-4-amine (PubChem CID 45090483) has the molecular formula C5H5F3N2
and a molecular weight of 150.10 g/mol. Its IUPAC name is N,N,2-trifluoro-2,3-dihydropyridin-4-amine.
Molecular Properties
| Compound Name | N,N,2-trifluoro-2,3-dihydropyridin-4-amine |
| PubChem CID | 45090483 |
| Molecular Formula | C5H5F3N2 |
| Molecular Weight | 150.10 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | N,N,2-trifluoro-2,3-dihydropyridin-4-amine |
| SMILES | FC1CC(N(F)F)=CC=N1 |
| InChI | InChI=1S/C5H5F3N2/c6-5-3-4(10(7)8)1-2-9-5/h1-2,5H,3H2 |
| InChIKey | GHZQQNZVMGXSLO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.10 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N,N,2-trifluoro-2,3-dihydropyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,2-trifluoro-2,3-dihydropyridin-4-amine?
The IUPAC name of N,N,2-trifluoro-2,3-dihydropyridin-4-amine (CID 45090483) is N,N,2-trifluoro-2,3-dihydropyridin-4-amine.
What is the SMILES notation for N,N,2-trifluoro-2,3-dihydropyridin-4-amine?
The canonical SMILES for N,N,2-trifluoro-2,3-dihydropyridin-4-amine is FC1CC(N(F)F)=CC=N1.
What is the InChIKey of N,N,2-trifluoro-2,3-dihydropyridin-4-amine?
The InChIKey is GHZQQNZVMGXSLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5F3N2/c6-5-3-4(10(7)8)1-2-9-5/h1-2,5H,3H2.
What are the key properties of N,N,2-trifluoro-2,3-dihydropyridin-4-amine?
N,N,2-trifluoro-2,3-dihydropyridin-4-amine has a molecular weight of 150.10 g/mol, XLogP of 1.71, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,2-trifluoro-2,3-dihydropyridin-4-amine is sourced from PubChem (CID 45090483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).