C9H14F2 — CID 45090704
6,6-difluoro-1,2,3,3a,4,5,7,7a-octahydroindene (PubChem CID 45090704) has the molecular formula C9H14F2 and a molecular weight of 160.21 g/mol. Its IUPAC name is 6,6-difluoro-1,2,3,3a,4,5,7,7a-octahydroindene.
| Compound Name | 6,6-difluoro-1,2,3,3a,4,5,7,7a-octahydroindene |
|---|---|
| PubChem CID | 45090704 |
| Molecular Formula | C9H14F2 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 6,6-difluoro-1,2,3,3a,4,5,7,7a-octahydroindene |
| SMILES | FC1(F)CCC2CCCC2C1 |
| InChI | InChI=1S/C9H14F2/c10-9(11)5-4-7-2-1-3-8(7)6-9/h7-8H,1-6H2 |
| InChIKey | ZSPDGLKQSHZRBI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |