C10H7FO — CID 45090759
3-fluoro-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene (PubChem CID 45090759) has the molecular formula C10H7FO and a molecular weight of 162.16 g/mol. Its IUPAC name is 3-fluoro-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene.
| Compound Name | 3-fluoro-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene |
|---|---|
| PubChem CID | 45090759 |
| Molecular Formula | C10H7FO |
| Molecular Weight | 162.16 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 3-fluoro-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene |
| SMILES | Fc1cccc2c1C1C=CC2O1 |
| InChI | InChI=1S/C10H7FO/c11-7-3-1-2-6-8-4-5-9(12-8)10(6)7/h1-5,8-9H |
| InChIKey | CDFYBNAGCHKVPE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.16 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|