About 6-ethoxy-2,4-dimethyl-2,3-dihydropyridine
6-ethoxy-2,4-dimethyl-2,3-dihydropyridine (PubChem CID 45090885) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 6-ethoxy-2,4-dimethyl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 6-ethoxy-2,4-dimethyl-2,3-dihydropyridine |
| PubChem CID | 45090885 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 6-ethoxy-2,4-dimethyl-2,3-dihydropyridine |
| SMILES | CCOC1=NC(C)CC(C)=C1 |
| InChI | InChI=1S/C9H15NO/c1-4-11-9-6-7(2)5-8(3)10-9/h6,8H,4-5H2,1-3H3 |
| InChIKey | GCLKIERYCVMHLE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethoxy-2,4-dimethyl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-2,4-dimethyl-2,3-dihydropyridine?
The IUPAC name of 6-ethoxy-2,4-dimethyl-2,3-dihydropyridine (CID 45090885) is 6-ethoxy-2,4-dimethyl-2,3-dihydropyridine.
What is the SMILES notation for 6-ethoxy-2,4-dimethyl-2,3-dihydropyridine?
The canonical SMILES for 6-ethoxy-2,4-dimethyl-2,3-dihydropyridine is CCOC1=NC(C)CC(C)=C1.
What is the InChIKey of 6-ethoxy-2,4-dimethyl-2,3-dihydropyridine?
The InChIKey is GCLKIERYCVMHLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-4-11-9-6-7(2)5-8(3)10-9/h6,8H,4-5H2,1-3H3.
What are the key properties of 6-ethoxy-2,4-dimethyl-2,3-dihydropyridine?
6-ethoxy-2,4-dimethyl-2,3-dihydropyridine has a molecular weight of 153.22 g/mol, XLogP of 2.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-2,4-dimethyl-2,3-dihydropyridine is sourced from PubChem (CID 45090885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).