About 7-ethoxy-2-methyl-3,4,5,6-tetrahydro-2H-azepine
7-ethoxy-2-methyl-3,4,5,6-tetrahydro-2H-azepine (PubChem CID 45090927) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is 7-ethoxy-2-methyl-3,4,5,6-tetrahydro-2H-azepine.
Molecular Properties
| Compound Name | 7-ethoxy-2-methyl-3,4,5,6-tetrahydro-2H-azepine |
| PubChem CID | 45090927 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 7-ethoxy-2-methyl-3,4,5,6-tetrahydro-2H-azepine |
| SMILES | CCOC1=NC(C)CCCC1 |
| InChI | InChI=1S/C9H17NO/c1-3-11-9-7-5-4-6-8(2)10-9/h8H,3-7H2,1-2H3 |
| InChIKey | ZYFJAFAVBYTBIH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-ethoxy-2-methyl-3,4,5,6-tetrahydro-2H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethoxy-2-methyl-3,4,5,6-tetrahydro-2H-azepine?
The IUPAC name of 7-ethoxy-2-methyl-3,4,5,6-tetrahydro-2H-azepine (CID 45090927) is 7-ethoxy-2-methyl-3,4,5,6-tetrahydro-2H-azepine.
What is the SMILES notation for 7-ethoxy-2-methyl-3,4,5,6-tetrahydro-2H-azepine?
The canonical SMILES for 7-ethoxy-2-methyl-3,4,5,6-tetrahydro-2H-azepine is CCOC1=NC(C)CCCC1.
What is the InChIKey of 7-ethoxy-2-methyl-3,4,5,6-tetrahydro-2H-azepine?
The InChIKey is ZYFJAFAVBYTBIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO/c1-3-11-9-7-5-4-6-8(2)10-9/h8H,3-7H2,1-2H3.
What are the key properties of 7-ethoxy-2-methyl-3,4,5,6-tetrahydro-2H-azepine?
7-ethoxy-2-methyl-3,4,5,6-tetrahydro-2H-azepine has a molecular weight of 155.24 g/mol, XLogP of 2.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethoxy-2-methyl-3,4,5,6-tetrahydro-2H-azepine is sourced from PubChem (CID 45090927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).