About 1-(5-ethoxy-1,3-oxazol-2-yl)ethanol
1-(5-ethoxy-1,3-oxazol-2-yl)ethanol (PubChem CID 45090957) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is 1-(5-ethoxy-1,3-oxazol-2-yl)ethanol.
Molecular Properties
| Compound Name | 1-(5-ethoxy-1,3-oxazol-2-yl)ethanol |
| PubChem CID | 45090957 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 1-(5-ethoxy-1,3-oxazol-2-yl)ethanol |
| SMILES | CCOc1cnc(C(C)O)o1 |
| InChI | InChI=1S/C7H11NO3/c1-3-10-6-4-8-7(11-6)5(2)9/h4-5,9H,3H2,1-2H3 |
| InChIKey | AWKQRKKSCYEXOW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-ethoxy-1,3-oxazol-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-ethoxy-1,3-oxazol-2-yl)ethanol?
The IUPAC name of 1-(5-ethoxy-1,3-oxazol-2-yl)ethanol (CID 45090957) is 1-(5-ethoxy-1,3-oxazol-2-yl)ethanol.
What is the SMILES notation for 1-(5-ethoxy-1,3-oxazol-2-yl)ethanol?
The canonical SMILES for 1-(5-ethoxy-1,3-oxazol-2-yl)ethanol is CCOc1cnc(C(C)O)o1.
What is the InChIKey of 1-(5-ethoxy-1,3-oxazol-2-yl)ethanol?
The InChIKey is AWKQRKKSCYEXOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-3-10-6-4-8-7(11-6)5(2)9/h4-5,9H,3H2,1-2H3.
What are the key properties of 1-(5-ethoxy-1,3-oxazol-2-yl)ethanol?
1-(5-ethoxy-1,3-oxazol-2-yl)ethanol has a molecular weight of 157.17 g/mol, XLogP of 1.13, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-ethoxy-1,3-oxazol-2-yl)ethanol is sourced from PubChem (CID 45090957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).