C11H16O2 — CID 45091292
2-ethoxy-2,3,4,5,6,7-hexahydroinden-1-one (PubChem CID 45091292) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-ethoxy-2,3,4,5,6,7-hexahydroinden-1-one.
| Compound Name | 2-ethoxy-2,3,4,5,6,7-hexahydroinden-1-one |
|---|---|
| PubChem CID | 45091292 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-ethoxy-2,3,4,5,6,7-hexahydroinden-1-one |
| SMILES | CCOC1CC2=C(CCCC2)C1=O |
| InChI | InChI=1S/C11H16O2/c1-2-13-10-7-8-5-3-4-6-9(8)11(10)12/h10H,2-7H2,1H3 |
| InChIKey | LTAYTTLOJLPYJV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |