C7H13N5O — CID 45091307
2-methoxy-4-N,4-N-dimethylpyrimidine-4,5,6-triamine (PubChem CID 45091307) has the molecular formula C7H13N5O and a molecular weight of 183.22 g/mol. Its IUPAC name is 2-methoxy-4-N,4-N-dimethylpyrimidine-4,5,6-triamine.
| Compound Name | 2-methoxy-4-N,4-N-dimethylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 45091307 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 2-methoxy-4-N,4-N-dimethylpyrimidine-4,5,6-triamine |
| SMILES | COc1nc(N)c(N)c(N(C)C)n1 |
| InChI | InChI=1S/C7H13N5O/c1-12(2)6-4(8)5(9)10-7(11-6)13-3/h8H2,1-3H3,(H2,9,10,11) |
| InChIKey | JPBMJCLJYCRTKZ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |