About 5-amino-4,6-dimethoxybenzene-1,3-diol
5-amino-4,6-dimethoxybenzene-1,3-diol (PubChem CID 45091349) has the molecular formula C8H11NO4
and a molecular weight of 185.18 g/mol. Its IUPAC name is 5-amino-4,6-dimethoxybenzene-1,3-diol.
Molecular Properties
| Compound Name | 5-amino-4,6-dimethoxybenzene-1,3-diol |
| PubChem CID | 45091349 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 5-amino-4,6-dimethoxybenzene-1,3-diol |
| SMILES | COc1c(O)cc(O)c(OC)c1N |
| InChI | InChI=1S/C8H11NO4/c1-12-7-4(10)3-5(11)8(13-2)6(7)9/h3,10-11H,9H2,1-2H3 |
| InChIKey | JYCJWZNVXSQIQV-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-4,6-dimethoxybenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4,6-dimethoxybenzene-1,3-diol?
The IUPAC name of 5-amino-4,6-dimethoxybenzene-1,3-diol (CID 45091349) is 5-amino-4,6-dimethoxybenzene-1,3-diol.
What is the SMILES notation for 5-amino-4,6-dimethoxybenzene-1,3-diol?
The canonical SMILES for 5-amino-4,6-dimethoxybenzene-1,3-diol is COc1c(O)cc(O)c(OC)c1N.
What is the InChIKey of 5-amino-4,6-dimethoxybenzene-1,3-diol?
The InChIKey is JYCJWZNVXSQIQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO4/c1-12-7-4(10)3-5(11)8(13-2)6(7)9/h3,10-11H,9H2,1-2H3.
What are the key properties of 5-amino-4,6-dimethoxybenzene-1,3-diol?
5-amino-4,6-dimethoxybenzene-1,3-diol has a molecular weight of 185.18 g/mol, XLogP of 0.70, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4,6-dimethoxybenzene-1,3-diol is sourced from PubChem (CID 45091349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).