C12H14O2 — CID 45091477
4-prop-2-enoxy-2-prop-2-enylphenol (PubChem CID 45091477) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 4-prop-2-enoxy-2-prop-2-enylphenol.
| Compound Name | 4-prop-2-enoxy-2-prop-2-enylphenol |
|---|---|
| PubChem CID | 45091477 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 4-prop-2-enoxy-2-prop-2-enylphenol |
| SMILES | C=CCOc1ccc(O)c(CC=C)c1 |
| InChI | InChI=1S/C12H14O2/c1-3-5-10-9-11(14-8-4-2)6-7-12(10)13/h3-4,6-7,9,13H,1-2,5,8H2 |
| InChIKey | JEWGSRVWGHNBQF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|