About tert-butyl-[(3S,4R)-4-hydroxyoxolan-3-yl]carbamic acid
tert-butyl-[(3S,4R)-4-hydroxyoxolan-3-yl]carbamic acid (PubChem CID 45091996) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is tert-butyl-[(3S,4R)-4-hydroxyoxolan-3-yl]carbamic acid.
Molecular Properties
| Compound Name | tert-butyl-[(3S,4R)-4-hydroxyoxolan-3-yl]carbamic acid |
| PubChem CID | 45091996 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | tert-butyl-[(3S,4R)-4-hydroxyoxolan-3-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)[C@H]1COC[C@@H]1O |
| InChI | InChI=1S/C9H17NO4/c1-9(2,3)10(8(12)13)6-4-14-5-7(6)11/h6-7,11H,4-5H2,1-3H3,(H,12,13)/t6-,7-/m0/s1 |
| InChIKey | UXBILTULPUFBNV-BQBZGAKWSA-N |
| XLogP | 0.52 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl-[(3S,4R)-4-hydroxyoxolan-3-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(3S,4R)-4-hydroxyoxolan-3-yl]carbamic acid?
The IUPAC name of tert-butyl-[(3S,4R)-4-hydroxyoxolan-3-yl]carbamic acid (CID 45091996) is tert-butyl-[(3S,4R)-4-hydroxyoxolan-3-yl]carbamic acid.
What is the SMILES notation for tert-butyl-[(3S,4R)-4-hydroxyoxolan-3-yl]carbamic acid?
The canonical SMILES for tert-butyl-[(3S,4R)-4-hydroxyoxolan-3-yl]carbamic acid is CC(C)(C)N(C(=O)O)[C@H]1COC[C@@H]1O.
What is the InChIKey of tert-butyl-[(3S,4R)-4-hydroxyoxolan-3-yl]carbamic acid?
The InChIKey is UXBILTULPUFBNV-BQBZGAKWSA-N. The full InChI is InChI=1S/C9H17NO4/c1-9(2,3)10(8(12)13)6-4-14-5-7(6)11/h6-7,11H,4-5H2,1-3H3,(H,12,13)/t6-,7-/m0/s1.
What are the key properties of tert-butyl-[(3S,4R)-4-hydroxyoxolan-3-yl]carbamic acid?
tert-butyl-[(3S,4R)-4-hydroxyoxolan-3-yl]carbamic acid has a molecular weight of 203.24 g/mol, XLogP of 0.52, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(3S,4R)-4-hydroxyoxolan-3-yl]carbamic acid is sourced from PubChem (CID 45091996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).