C9H17NO4 — CID 45091996
tert-butyl-[(3S,4R)-4-hydroxyoxolan-3-yl]carbamic acid (PubChem CID 45091996) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is tert-butyl-[(3S,4R)-4-hydroxyoxolan-3-yl]carbamic acid.
| Compound Name | tert-butyl-[(3S,4R)-4-hydroxyoxolan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 45091996 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | tert-butyl-[(3S,4R)-4-hydroxyoxolan-3-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)[C@H]1COC[C@@H]1O |
| InChI | InChI=1S/C9H17NO4/c1-9(2,3)10(8(12)13)6-4-14-5-7(6)11/h6-7,11H,4-5H2,1-3H3,(H,12,13)/t6-,7-/m0/s1 |
| InChIKey | UXBILTULPUFBNV-BQBZGAKWSA-N |
| XLogP | 0.52 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |