C10H14N2O3 — CID 45092132
2-cyclopropylpent-4-yn-2-yl N-carbamoylcarbamate (PubChem CID 45092132) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-cyclopropylpent-4-yn-2-yl N-carbamoylcarbamate.
| Compound Name | 2-cyclopropylpent-4-yn-2-yl N-carbamoylcarbamate |
|---|---|
| PubChem CID | 45092132 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-cyclopropylpent-4-yn-2-yl N-carbamoylcarbamate |
| SMILES | C#CCC(C)(OC(=O)NC(N)=O)C1CC1 |
| InChI | InChI=1S/C10H14N2O3/c1-3-6-10(2,7-4-5-7)15-9(14)12-8(11)13/h1,7H,4-6H2,2H3,(H3,11,12,13,14) |
| InChIKey | MRJXZGDNGANHFH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|