About [(2S)-1-amino-3,3-dimethylbutan-2-yl]-tert-butylcarbamic acid
[(2S)-1-amino-3,3-dimethylbutan-2-yl]-tert-butylcarbamic acid (PubChem CID 45092257) has the molecular formula C11H24N2O2
and a molecular weight of 216.32 g/mol. Its IUPAC name is [(2S)-1-amino-3,3-dimethylbutan-2-yl]-tert-butylcarbamic acid.
Molecular Properties
| Compound Name | [(2S)-1-amino-3,3-dimethylbutan-2-yl]-tert-butylcarbamic acid |
| PubChem CID | 45092257 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | [(2S)-1-amino-3,3-dimethylbutan-2-yl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)[C@@H](CN)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C11H24N2O2/c1-10(2,3)8(7-12)13(9(14)15)11(4,5)6/h8H,7,12H2,1-6H3,(H,14,15)/t8-/m1/s1 |
| InChIKey | KYXCGOPBPKECER-MRVPVSSYSA-N |
| XLogP | 2.14 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2S)-1-amino-3,3-dimethylbutan-2-yl]-tert-butylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-amino-3,3-dimethylbutan-2-yl]-tert-butylcarbamic acid?
The IUPAC name of [(2S)-1-amino-3,3-dimethylbutan-2-yl]-tert-butylcarbamic acid (CID 45092257) is [(2S)-1-amino-3,3-dimethylbutan-2-yl]-tert-butylcarbamic acid.
What is the SMILES notation for [(2S)-1-amino-3,3-dimethylbutan-2-yl]-tert-butylcarbamic acid?
The canonical SMILES for [(2S)-1-amino-3,3-dimethylbutan-2-yl]-tert-butylcarbamic acid is CC(C)(C)[C@@H](CN)N(C(=O)O)C(C)(C)C.
What is the InChIKey of [(2S)-1-amino-3,3-dimethylbutan-2-yl]-tert-butylcarbamic acid?
The InChIKey is KYXCGOPBPKECER-MRVPVSSYSA-N. The full InChI is InChI=1S/C11H24N2O2/c1-10(2,3)8(7-12)13(9(14)15)11(4,5)6/h8H,7,12H2,1-6H3,(H,14,15)/t8-/m1/s1.
What are the key properties of [(2S)-1-amino-3,3-dimethylbutan-2-yl]-tert-butylcarbamic acid?
[(2S)-1-amino-3,3-dimethylbutan-2-yl]-tert-butylcarbamic acid has a molecular weight of 216.32 g/mol, XLogP of 2.14, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-amino-3,3-dimethylbutan-2-yl]-tert-butylcarbamic acid is sourced from PubChem (CID 45092257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).