C7H11NO — CID 45092682
(3R,4R)-3,4,5-trimethyl-3,4-dihydropyrrol-2-one (PubChem CID 45092682) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is (3R,4R)-3,4,5-trimethyl-3,4-dihydropyrrol-2-one.
| Compound Name | (3R,4R)-3,4,5-trimethyl-3,4-dihydropyrrol-2-one |
|---|---|
| PubChem CID | 45092682 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (3R,4R)-3,4,5-trimethyl-3,4-dihydropyrrol-2-one |
| SMILES | CC1=NC(=O)[C@H](C)[C@H]1C |
| InChI | InChI=1S/C7H11NO/c1-4-5(2)7(9)8-6(4)3/h4-5H,1-3H3/t4-,5-/m1/s1 |
| InChIKey | LFPKRQPACWFFHS-RFZPGFLSSA-N |
| XLogP | 1.26 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |