About 5-prop-1-en-2-yl-2,3-diazabicyclo[2.2.2]oct-2-ene
5-prop-1-en-2-yl-2,3-diazabicyclo[2.2.2]oct-2-ene (PubChem CID 45092734) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 5-prop-1-en-2-yl-2,3-diazabicyclo[2.2.2]oct-2-ene.
Molecular Properties
| Compound Name | 5-prop-1-en-2-yl-2,3-diazabicyclo[2.2.2]oct-2-ene |
| PubChem CID | 45092734 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 5-prop-1-en-2-yl-2,3-diazabicyclo[2.2.2]oct-2-ene |
| SMILES | C=C(C)C1CC2CCC1N=N2 |
| InChI | InChI=1S/C9H14N2/c1-6(2)8-5-7-3-4-9(8)11-10-7/h7-9H,1,3-5H2,2H3 |
| InChIKey | UVAYZLODYLNQLM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-prop-1-en-2-yl-2,3-diazabicyclo[2.2.2]oct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-prop-1-en-2-yl-2,3-diazabicyclo[2.2.2]oct-2-ene?
The IUPAC name of 5-prop-1-en-2-yl-2,3-diazabicyclo[2.2.2]oct-2-ene (CID 45092734) is 5-prop-1-en-2-yl-2,3-diazabicyclo[2.2.2]oct-2-ene.
What is the SMILES notation for 5-prop-1-en-2-yl-2,3-diazabicyclo[2.2.2]oct-2-ene?
The canonical SMILES for 5-prop-1-en-2-yl-2,3-diazabicyclo[2.2.2]oct-2-ene is C=C(C)C1CC2CCC1N=N2.
What is the InChIKey of 5-prop-1-en-2-yl-2,3-diazabicyclo[2.2.2]oct-2-ene?
The InChIKey is UVAYZLODYLNQLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-6(2)8-5-7-3-4-9(8)11-10-7/h7-9H,1,3-5H2,2H3.
What are the key properties of 5-prop-1-en-2-yl-2,3-diazabicyclo[2.2.2]oct-2-ene?
5-prop-1-en-2-yl-2,3-diazabicyclo[2.2.2]oct-2-ene has a molecular weight of 150.22 g/mol, XLogP of 2.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-prop-1-en-2-yl-2,3-diazabicyclo[2.2.2]oct-2-ene is sourced from PubChem (CID 45092734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).