About 4-cyclopropylpiperidine
4-cyclopropylpiperidine (PubChem CID 45092777) has the molecular formula C8H15N
and a molecular weight of 125.22 g/mol. Its IUPAC name is 4-cyclopropylpiperidine.
Molecular Properties
| Compound Name | 4-cyclopropylpiperidine |
| PubChem CID | 45092777 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.22 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 4-cyclopropylpiperidine |
| SMILES | C1CC(C2CC2)CCN1 |
| InChI | InChI=1S/C8H15N/c1-2-7(1)8-3-5-9-6-4-8/h7-9H,1-6H2 |
| InChIKey | NCNVPWCTEBODPS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclopropylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropylpiperidine?
The IUPAC name of 4-cyclopropylpiperidine (CID 45092777) is 4-cyclopropylpiperidine.
What is the SMILES notation for 4-cyclopropylpiperidine?
The canonical SMILES for 4-cyclopropylpiperidine is C1CC(C2CC2)CCN1.
What is the InChIKey of 4-cyclopropylpiperidine?
The InChIKey is NCNVPWCTEBODPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N/c1-2-7(1)8-3-5-9-6-4-8/h7-9H,1-6H2.
What are the key properties of 4-cyclopropylpiperidine?
4-cyclopropylpiperidine has a molecular weight of 125.22 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropylpiperidine is sourced from PubChem (CID 45092777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).