About 6-phenylcyclohexa-3,5-diene-1,1,2-triol
6-phenylcyclohexa-3,5-diene-1,1,2-triol (PubChem CID 45092919) has the molecular formula C12H12O3
and a molecular weight of 204.23 g/mol. Its IUPAC name is 6-phenylcyclohexa-3,5-diene-1,1,2-triol.
Molecular Properties
| Compound Name | 6-phenylcyclohexa-3,5-diene-1,1,2-triol |
| PubChem CID | 45092919 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 6-phenylcyclohexa-3,5-diene-1,1,2-triol |
| SMILES | OC1C=CC=C(c2ccccc2)C1(O)O |
| InChI | InChI=1S/C12H12O3/c13-11-8-4-7-10(12(11,14)15)9-5-2-1-3-6-9/h1-8,11,13-15H |
| InChIKey | TVFYLUZGPDKJSP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-phenylcyclohexa-3,5-diene-1,1,2-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenylcyclohexa-3,5-diene-1,1,2-triol?
The IUPAC name of 6-phenylcyclohexa-3,5-diene-1,1,2-triol (CID 45092919) is 6-phenylcyclohexa-3,5-diene-1,1,2-triol.
What is the SMILES notation for 6-phenylcyclohexa-3,5-diene-1,1,2-triol?
The canonical SMILES for 6-phenylcyclohexa-3,5-diene-1,1,2-triol is OC1C=CC=C(c2ccccc2)C1(O)O.
What is the InChIKey of 6-phenylcyclohexa-3,5-diene-1,1,2-triol?
The InChIKey is TVFYLUZGPDKJSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O3/c13-11-8-4-7-10(12(11,14)15)9-5-2-1-3-6-9/h1-8,11,13-15H.
What are the key properties of 6-phenylcyclohexa-3,5-diene-1,1,2-triol?
6-phenylcyclohexa-3,5-diene-1,1,2-triol has a molecular weight of 204.23 g/mol, XLogP of 0.68, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenylcyclohexa-3,5-diene-1,1,2-triol is sourced from PubChem (CID 45092919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).