C12H16O3 — CID 45093087
2,2,4-trimethyl-3,4-dihydrochromene-6,7-diol (PubChem CID 45093087) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2,2,4-trimethyl-3,4-dihydrochromene-6,7-diol.
| Compound Name | 2,2,4-trimethyl-3,4-dihydrochromene-6,7-diol |
|---|---|
| PubChem CID | 45093087 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2,2,4-trimethyl-3,4-dihydrochromene-6,7-diol |
| SMILES | CC1CC(C)(C)Oc2cc(O)c(O)cc21 |
| InChI | InChI=1S/C12H16O3/c1-7-6-12(2,3)15-11-5-10(14)9(13)4-8(7)11/h4-5,7,13-14H,6H2,1-3H3 |
| InChIKey | OSNZWOYPXIMCTE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|